C15H18N2O4 — CID 166759403
benzyl N-(2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-6-yl)carbamate (PubChem CID 166759403) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is benzyl N-(2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-6-yl)carbamate.
| Compound Name | benzyl N-(2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-6-yl)carbamate |
|---|---|
| PubChem CID | 166759403 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | benzyl N-(2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-6-yl)carbamate |
| SMILES | O=C(NC1CCC2NC(=O)OC2C1)OCc1ccccc1 |
| InChI | InChI=1S/C15H18N2O4/c18-14(20-9-10-4-2-1-3-5-10)16-11-6-7-12-13(8-11)21-15(19)17-12/h1-5,11-13H,6-9H2,(H,16,18)(H,17,19) |
| InChIKey | PHWJNLQUWBFUDD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |