C14H11F3N4O2 — CID 166761743
1-[(E)-N-(methylideneamino)-C-[(Z)-prop-1-enyl]carbonimidoyl]-7-(trifluoromethyl)quinazoline-2,4-dione (PubChem CID 166761743) has the molecular formula C14H11F3N4O2 and a molecular weight of 324.26 g/mol. Its IUPAC name is 1-[(E)-N-(methylideneamino)-C-[(Z)-prop-1-enyl]carbonimidoyl]-7-(trifluoromethyl)quinazoline-2,4-dione.
| Compound Name | 1-[(E)-N-(methylideneamino)-C-[(Z)-prop-1-enyl]carbonimidoyl]-7-(trifluoromethyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 166761743 |
| Molecular Formula | C14H11F3N4O2 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 1-[(E)-N-(methylideneamino)-C-[(Z)-prop-1-enyl]carbonimidoyl]-7-(trifluoromethyl)quinazoline-2,4-dione |
| SMILES | C=N/N=C(\C=C/C)n1c(=O)[nH]c(=O)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C14H11F3N4O2/c1-3-4-11(20-18-2)21-10-7-8(14(15,16)17)5-6-9(10)12(22)19-13(21)23/h3-7H,2H2,1H3,(H,19,22,23)/b4-3-,20-11+ |
| InChIKey | YCCVJZQNTDONNX-OXOYHDAYSA-N |
| XLogP | 2.15 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|