C22H24N2 — CID 166763124
3-[1-(4-butylanilino)ethenyl]-2-prop-1-en-2-ylbenzonitrile (PubChem CID 166763124) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 3-[1-(4-butylanilino)ethenyl]-2-prop-1-en-2-ylbenzonitrile.
| Compound Name | 3-[1-(4-butylanilino)ethenyl]-2-prop-1-en-2-ylbenzonitrile |
|---|---|
| PubChem CID | 166763124 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 3-[1-(4-butylanilino)ethenyl]-2-prop-1-en-2-ylbenzonitrile |
| SMILES | C=C(Nc1ccc(CCCC)cc1)c1cccc(C#N)c1C(=C)C |
| InChI | InChI=1S/C22H24N2/c1-5-6-8-18-11-13-20(14-12-18)24-17(4)21-10-7-9-19(15-23)22(21)16(2)3/h7,9-14,24H,2,4-6,8H2,1,3H3 |
| InChIKey | GWMBJWQILHHORD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |