C12H13F3N2O2 — CID 166763610
4-but-3-enoxy-N'-hydroxy-3-(trifluoromethyl)benzenecarboximidamide (PubChem CID 166763610) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 4-but-3-enoxy-N'-hydroxy-3-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 4-but-3-enoxy-N'-hydroxy-3-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 166763610 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4-but-3-enoxy-N'-hydroxy-3-(trifluoromethyl)benzenecarboximidamide |
| SMILES | C=CCCOc1ccc(/C(N)=N/O)cc1C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O2/c1-2-3-6-19-10-5-4-8(11(16)17-18)7-9(10)12(13,14)15/h2,4-5,7,18H,1,3,6H2,(H2,16,17) |
| InChIKey | XJTKYVSNFXDMAG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|