C17H15ClN4O2S — CID 16676552
2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[(2-chlorophenyl)methyl]acetamide (PubChem CID 16676552) has the molecular formula C17H15ClN4O2S and a molecular weight of 374.85 g/mol. Its IUPAC name is 2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[(2-chlorophenyl)methyl]acetamide.
| Compound Name | 2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[(2-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 16676552 |
| Molecular Formula | C17H15ClN4O2S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[(2-chlorophenyl)methyl]acetamide |
| SMILES | Nc1cc(-c2cccs2)nn(CC(=O)NCc2ccccc2Cl)c1=O |
| InChI | InChI=1S/C17H15ClN4O2S/c18-12-5-2-1-4-11(12)9-20-16(23)10-22-17(24)13(19)8-14(21-22)15-6-3-7-25-15/h1-8H,9-10,19H2,(H,20,23) |
| InChIKey | SAGTZWJXKSCQAD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |