C14H18N4O3S — CID 51591864
2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[(2S)-1-methoxypropan-2-yl]acetamide (PubChem CID 51591864) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[(2S)-1-methoxypropan-2-yl]acetamide.
| Compound Name | 2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[(2S)-1-methoxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 51591864 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[(2S)-1-methoxypropan-2-yl]acetamide |
| SMILES | COC[C@H](C)NC(=O)Cn1nc(-c2cccs2)cc(N)c1=O |
| InChI | InChI=1S/C14H18N4O3S/c1-9(8-21-2)16-13(19)7-18-14(20)10(15)6-11(17-18)12-4-3-5-22-12/h3-6,9H,7-8,15H2,1-2H3,(H,16,19)/t9-/m0/s1 |
| InChIKey | VGBQQULCCGKGPR-VIFPVBQESA-N |
| XLogP | 0.71 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |