C15H18N4O3S — CID 51589163
2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide (PubChem CID 51589163) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 51589163 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
| SMILES | Nc1cc(-c2cccs2)nn(CC(=O)NC[C@H]2CCCO2)c1=O |
| InChI | InChI=1S/C15H18N4O3S/c16-11-7-12(13-4-2-6-23-13)18-19(15(11)21)9-14(20)17-8-10-3-1-5-22-10/h2,4,6-7,10H,1,3,5,8-9,16H2,(H,17,20)/t10-/m1/s1 |
| InChIKey | OWQFGRBJHCYFMF-SNVBAGLBSA-N |
| XLogP | 0.85 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |