C22H25N5O2S — CID 51493146
2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]acetamide (PubChem CID 51493146) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]acetamide.
| Compound Name | 2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 51493146 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-(5-amino-6-oxo-3-thiophen-2-ylpyridazin-1-yl)-N-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]acetamide |
| SMILES | C[C@@H]1CCCN(c2ccc(NC(=O)Cn3nc(-c4cccs4)cc(N)c3=O)cc2)C1 |
| InChI | InChI=1S/C22H25N5O2S/c1-15-4-2-10-26(13-15)17-8-6-16(7-9-17)24-21(28)14-27-22(29)18(23)12-19(25-27)20-5-3-11-30-20/h3,5-9,11-12,15H,2,4,10,13-14,23H2,1H3,(H,24,28)/t15-/m1/s1 |
| InChIKey | NXUSNPHYXZUVLQ-OAHLLOKOSA-N |
| XLogP | 3.43 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|