C13H21NO — CID 166767016
N-[(E)-2-ethenyl-3,3-dimethylhex-1-enyl]prop-2-enamide (PubChem CID 166767016) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is N-[(E)-2-ethenyl-3,3-dimethylhex-1-enyl]prop-2-enamide.
| Compound Name | N-[(E)-2-ethenyl-3,3-dimethylhex-1-enyl]prop-2-enamide |
|---|---|
| PubChem CID | 166767016 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-[(E)-2-ethenyl-3,3-dimethylhex-1-enyl]prop-2-enamide |
| SMILES | C=CC(=O)N/C=C(\C=C)C(C)(C)CCC |
| InChI | InChI=1S/C13H21NO/c1-6-9-13(4,5)11(7-2)10-14-12(15)8-3/h7-8,10H,2-3,6,9H2,1,4-5H3,(H,14,15)/b11-10+ |
| InChIKey | AZKJGTYABYVKLS-ZHACJKMWSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|