C9H19NO2Si — CID 173106708
N-(2-methylpentan-2-yloxysilyl)prop-2-enamide (PubChem CID 173106708) has the molecular formula C9H19NO2Si and a molecular weight of 201.34 g/mol. Its IUPAC name is N-(2-methylpentan-2-yloxysilyl)prop-2-enamide.
| Compound Name | N-(2-methylpentan-2-yloxysilyl)prop-2-enamide |
|---|---|
| PubChem CID | 173106708 |
| Molecular Formula | C9H19NO2Si |
| Molecular Weight | 201.34 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | N-(2-methylpentan-2-yloxysilyl)prop-2-enamide |
| SMILES | C=CC(=O)N[SiH2]OC(C)(C)CCC |
| InChI | InChI=1S/C9H19NO2Si/c1-5-7-9(3,4)12-13-10-8(11)6-2/h6H,2,5,7,13H2,1,3-4H3,(H,10,11) |
| InChIKey | VQWPXBXJZJMROE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|