C16H31NO — CID 130271966
N-(2-butyl-2-methyloctyl)prop-2-enamide (PubChem CID 130271966) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is N-(2-butyl-2-methyloctyl)prop-2-enamide.
| Compound Name | N-(2-butyl-2-methyloctyl)prop-2-enamide |
|---|---|
| PubChem CID | 130271966 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | N-(2-butyl-2-methyloctyl)prop-2-enamide |
| SMILES | C=CC(=O)NCC(C)(CCCC)CCCCCC |
| InChI | InChI=1S/C16H31NO/c1-5-8-10-11-13-16(4,12-9-6-2)14-17-15(18)7-3/h7H,3,5-6,8-14H2,1-2,4H3,(H,17,18) |
| InChIKey | KZTFHLMVMMGEQM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|