C17H33NO3S — CID 138622924
N-[2-(4-methylundecan-4-ylsulfonyl)ethyl]prop-2-enamide (PubChem CID 138622924) has the molecular formula C17H33NO3S and a molecular weight of 331.52 g/mol. Its IUPAC name is N-[2-(4-methylundecan-4-ylsulfonyl)ethyl]prop-2-enamide.
| Compound Name | N-[2-(4-methylundecan-4-ylsulfonyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 138622924 |
| Molecular Formula | C17H33NO3S |
| Molecular Weight | 331.52 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | N-[2-(4-methylundecan-4-ylsulfonyl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCS(=O)(=O)C(C)(CCC)CCCCCCC |
| InChI | InChI=1S/C17H33NO3S/c1-5-8-9-10-11-13-17(4,12-6-2)22(20,21)15-14-18-16(19)7-3/h7H,3,5-6,8-15H2,1-2,4H3,(H,18,19) |
| InChIKey | ZZMNMMCUARSBQB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|