C11H21NO4S — CID 175545774
propyl 2-(prop-2-enoylamino)pentane-2-sulfonate (PubChem CID 175545774) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is propyl 2-(prop-2-enoylamino)pentane-2-sulfonate.
| Compound Name | propyl 2-(prop-2-enoylamino)pentane-2-sulfonate |
|---|---|
| PubChem CID | 175545774 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | propyl 2-(prop-2-enoylamino)pentane-2-sulfonate |
| SMILES | C=CC(=O)NC(C)(CCC)S(=O)(=O)OCCC |
| InChI | InChI=1S/C11H21NO4S/c1-5-8-11(4,12-10(13)7-3)17(14,15)16-9-6-2/h7H,3,5-6,8-9H2,1-2,4H3,(H,12,13) |
| InChIKey | NICHIUJPDMDNHM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|