C17H34NNaO4S — CID 175299957
sodium;ethyl 2-(prop-2-enoylamino)dodecane-2-sulfonate;hydride (PubChem CID 175299957) has the molecular formula C17H34NNaO4S and a molecular weight of 371.52 g/mol. Its IUPAC name is sodium;ethyl 2-(prop-2-enoylamino)dodecane-2-sulfonate;hydride.
| Compound Name | sodium;ethyl 2-(prop-2-enoylamino)dodecane-2-sulfonate;hydride |
|---|---|
| PubChem CID | 175299957 |
| Molecular Formula | C17H34NNaO4S |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | sodium;ethyl 2-(prop-2-enoylamino)dodecane-2-sulfonate;hydride |
| SMILES | C=CC(=O)NC(C)(CCCCCCCCCC)S(=O)(=O)OCC.[H-].[Na+] |
| InChI | InChI=1S/C17H33NO4S.Na.H/c1-5-8-9-10-11-12-13-14-15-17(4,18-16(19)6-2)23(20,21)22-7-3;;/h6H,2,5,7-15H2,1,3-4H3,(H,18,19);;/q;+1;-1 |
| InChIKey | DUCHWNIJTQSVDF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|