C10H17F2NO — CID 166767269
(E)-2,2-difluoro-N-(2-methylpropyl)hex-4-enamide (PubChem CID 166767269) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is (E)-2,2-difluoro-N-(2-methylpropyl)hex-4-enamide.
| Compound Name | (E)-2,2-difluoro-N-(2-methylpropyl)hex-4-enamide |
|---|---|
| PubChem CID | 166767269 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (E)-2,2-difluoro-N-(2-methylpropyl)hex-4-enamide |
| SMILES | C/C=C/CC(F)(F)C(=O)NCC(C)C |
| InChI | InChI=1S/C10H17F2NO/c1-4-5-6-10(11,12)9(14)13-7-8(2)3/h4-5,8H,6-7H2,1-3H3,(H,13,14)/b5-4+ |
| InChIKey | WVABPTABYBRCQM-SNAWJCMRSA-N |
| XLogP | 2.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|