C8H13I2N3O4 — CID 166769855
5-amino-2-[iodo-[2-(iodoamino)propanoyl]amino]-5-oxopentanoic acid (PubChem CID 166769855) has the molecular formula C8H13I2N3O4 and a molecular weight of 469.02 g/mol. Its IUPAC name is 5-amino-2-[iodo-[2-(iodoamino)propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[iodo-[2-(iodoamino)propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 166769855 |
| Molecular Formula | C8H13I2N3O4 |
| Molecular Weight | 469.02 g/mol |
| Exact Mass | 468.90 |
| IUPAC Name | 5-amino-2-[iodo-[2-(iodoamino)propanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(NI)C(=O)N(I)C(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H13I2N3O4/c1-4(12-9)7(15)13(10)5(8(16)17)2-3-6(11)14/h4-5,12H,2-3H2,1H3,(H2,11,14)(H,16,17) |
| InChIKey | UBVKAWPFAYXIJO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.02 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|