C10H21N3O5 — CID 88599002
(2S)-5-amino-2-[(1,1-dihydroxyethylamino)-propylamino]-5-oxopentanoic acid (PubChem CID 88599002) has the molecular formula C10H21N3O5 and a molecular weight of 263.29 g/mol. Its IUPAC name is (2S)-5-amino-2-[(1,1-dihydroxyethylamino)-propylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[(1,1-dihydroxyethylamino)-propylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 88599002 |
| Molecular Formula | C10H21N3O5 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (2S)-5-amino-2-[(1,1-dihydroxyethylamino)-propylamino]-5-oxopentanoic acid |
| SMILES | CCCN(NC(C)(O)O)[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H21N3O5/c1-3-6-13(12-10(2,17)18)7(9(15)16)4-5-8(11)14/h7,12,17-18H,3-6H2,1-2H3,(H2,11,14)(H,15,16)/t7-/m0/s1 |
| InChIKey | KSLITWOTMFGULM-ZETCQYMHSA-N |
| XLogP | -1.42 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|