C9H18N4O4 — CID 175602366
5-amino-2-[(carbamoylamino)-propylamino]-5-oxopentanoic acid (PubChem CID 175602366) has the molecular formula C9H18N4O4 and a molecular weight of 246.27 g/mol. Its IUPAC name is 5-amino-2-[(carbamoylamino)-propylamino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(carbamoylamino)-propylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175602366 |
| Molecular Formula | C9H18N4O4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 5-amino-2-[(carbamoylamino)-propylamino]-5-oxopentanoic acid |
| SMILES | CCCN(NC(N)=O)C(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H18N4O4/c1-2-5-13(12-9(11)17)6(8(15)16)3-4-7(10)14/h6H,2-5H2,1H3,(H2,10,14)(H,15,16)(H3,11,12,17) |
| InChIKey | XHZCFSHBNXZPGA-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|