C17H31NO4 — CID 166771750
(2S)-2-[(4-butylcyclohexyl)oxycarbonylamino]-4-methylpentanoic acid (PubChem CID 166771750) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is (2S)-2-[(4-butylcyclohexyl)oxycarbonylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(4-butylcyclohexyl)oxycarbonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 166771750 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | (2S)-2-[(4-butylcyclohexyl)oxycarbonylamino]-4-methylpentanoic acid |
| SMILES | CCCCC1CCC(OC(=O)N[C@@H](CC(C)C)C(=O)O)CC1 |
| InChI | InChI=1S/C17H31NO4/c1-4-5-6-13-7-9-14(10-8-13)22-17(21)18-15(16(19)20)11-12(2)3/h12-15H,4-11H2,1-3H3,(H,18,21)(H,19,20)/t13?,14?,15-/m0/s1 |
| InChIKey | JILYJUQZZOSKQP-NRXISQOPSA-N |
| XLogP | 3.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |