C20H45NO — CID 166773376
butane;N,N-dioctylhydroxylamine (PubChem CID 166773376) has the molecular formula C20H45NO and a molecular weight of 315.59 g/mol. Its IUPAC name is butane;N,N-dioctylhydroxylamine.
| Compound Name | butane;N,N-dioctylhydroxylamine |
|---|---|
| PubChem CID | 166773376 |
| Molecular Formula | C20H45NO |
| Molecular Weight | 315.59 g/mol |
| Exact Mass | 315.35 |
| IUPAC Name | butane;N,N-dioctylhydroxylamine |
| SMILES | CCCC.CCCCCCCCN(O)CCCCCCCC |
| InChI | InChI=1S/C16H35NO.C4H10/c1-3-5-7-9-11-13-15-17(18)16-14-12-10-8-6-4-2;1-3-4-2/h18H,3-16H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | CPLFGUPYLMAHDQ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.59 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|