C15H35NO — CID 166773382
N,N-dihexylhydroxylamine;propane (PubChem CID 166773382) has the molecular formula C15H35NO and a molecular weight of 245.45 g/mol. Its IUPAC name is N,N-dihexylhydroxylamine;propane.
| Compound Name | N,N-dihexylhydroxylamine;propane |
|---|---|
| PubChem CID | 166773382 |
| Molecular Formula | C15H35NO |
| Molecular Weight | 245.45 g/mol |
| Exact Mass | 245.27 |
| IUPAC Name | N,N-dihexylhydroxylamine;propane |
| SMILES | CCC.CCCCCCN(O)CCCCCC |
| InChI | InChI=1S/C12H27NO.C3H8/c1-3-5-7-9-11-13(14)12-10-8-6-4-2;1-3-2/h14H,3-12H2,1-2H3;3H2,1-2H3 |
| InChIKey | DLGAEKNBAFNXCH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|