C17H21NS — CID 166774489
3-[(1Z)-2-but-1-en-2-ylsulfanyl-3-methylbuta-1,3-dienyl]-5,6-dihydro-1H-indole (PubChem CID 166774489) has the molecular formula C17H21NS and a molecular weight of 271.43 g/mol. Its IUPAC name is 3-[(1Z)-2-but-1-en-2-ylsulfanyl-3-methylbuta-1,3-dienyl]-5,6-dihydro-1H-indole.
| Compound Name | 3-[(1Z)-2-but-1-en-2-ylsulfanyl-3-methylbuta-1,3-dienyl]-5,6-dihydro-1H-indole |
|---|---|
| PubChem CID | 166774489 |
| Molecular Formula | C17H21NS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-[(1Z)-2-but-1-en-2-ylsulfanyl-3-methylbuta-1,3-dienyl]-5,6-dihydro-1H-indole |
| SMILES | C=C(CC)S/C(=C\c1c[nH]c2c1=CCCC=2)C(=C)C |
| InChI | InChI=1S/C17H21NS/c1-5-13(4)19-17(12(2)3)10-14-11-18-16-9-7-6-8-15(14)16/h8-11,18H,2,4-7H2,1,3H3/b17-10- |
| InChIKey | FXHPVWXIAZRUPK-YVLHZVERSA-N |
| XLogP | 3.94 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|