C13H15BrFNO — CID 166775766
5-bromo-1-butanimidoyl-4-fluoro-2,3-dihydroinden-1-ol (PubChem CID 166775766) has the molecular formula C13H15BrFNO and a molecular weight of 300.17 g/mol. Its IUPAC name is 5-bromo-1-butanimidoyl-4-fluoro-2,3-dihydroinden-1-ol.
| Compound Name | 5-bromo-1-butanimidoyl-4-fluoro-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 166775766 |
| Molecular Formula | C13H15BrFNO |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 5-bromo-1-butanimidoyl-4-fluoro-2,3-dihydroinden-1-ol |
| SMILES | [H]/N=C(\CCC)C1(O)CCc2c1ccc(Br)c2F |
| InChI | InChI=1S/C13H15BrFNO/c1-2-3-11(16)13(17)7-6-8-9(13)4-5-10(14)12(8)15/h4-5,16-17H,2-3,6-7H2,1H3/b16-11+ |
| InChIKey | QBLJIMBOGWSQGV-LFIBNONCSA-N |
| XLogP | 3.54 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|