C11H19F2N — CID 166778613
4-(1,1-difluoroprop-2-enyl)-1-propan-2-ylpiperidine (PubChem CID 166778613) has the molecular formula C11H19F2N and a molecular weight of 203.28 g/mol. Its IUPAC name is 4-(1,1-difluoroprop-2-enyl)-1-propan-2-ylpiperidine.
| Compound Name | 4-(1,1-difluoroprop-2-enyl)-1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 166778613 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 4-(1,1-difluoroprop-2-enyl)-1-propan-2-ylpiperidine |
| SMILES | C=CC(F)(F)C1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C11H19F2N/c1-4-11(12,13)10-5-7-14(8-6-10)9(2)3/h4,9-10H,1,5-8H2,2-3H3 |
| InChIKey | JEGHFQUTQDVXNL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|