C10H14F5N — CID 146426189
1-(2,3-difluorobut-3-en-2-yl)-4-(trifluoromethyl)piperidine (PubChem CID 146426189) has the molecular formula C10H14F5N and a molecular weight of 243.22 g/mol. Its IUPAC name is 1-(2,3-difluorobut-3-en-2-yl)-4-(trifluoromethyl)piperidine.
| Compound Name | 1-(2,3-difluorobut-3-en-2-yl)-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 146426189 |
| Molecular Formula | C10H14F5N |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-(2,3-difluorobut-3-en-2-yl)-4-(trifluoromethyl)piperidine |
| SMILES | C=C(F)C(C)(F)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H14F5N/c1-7(11)9(2,12)16-5-3-8(4-6-16)10(13,14)15/h8H,1,3-6H2,2H3 |
| InChIKey | RXOITCAMCVJERC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|