C10H10F9N — CID 129207487
3,5-bis(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine (PubChem CID 129207487) has the molecular formula C10H10F9N and a molecular weight of 315.18 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine.
| Compound Name | 3,5-bis(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine |
|---|---|
| PubChem CID | 129207487 |
| Molecular Formula | C10H10F9N |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 3,5-bis(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine |
| SMILES | C=C(F)C(F)(F)N1CC(C(F)(F)F)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H10F9N/c1-5(11)10(18,19)20-3-6(8(12,13)14)2-7(4-20)9(15,16)17/h6-7H,1-4H2 |
| InChIKey | JEEQUCJDKCSIQZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|