C11H10F11N — CID 129207490
1-(1,1,1,2,3-pentafluorobut-3-en-2-yl)-3,5-bis(trifluoromethyl)piperidine (PubChem CID 129207490) has the molecular formula C11H10F11N and a molecular weight of 365.19 g/mol. Its IUPAC name is 1-(1,1,1,2,3-pentafluorobut-3-en-2-yl)-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-(1,1,1,2,3-pentafluorobut-3-en-2-yl)-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 129207490 |
| Molecular Formula | C11H10F11N |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 1-(1,1,1,2,3-pentafluorobut-3-en-2-yl)-3,5-bis(trifluoromethyl)piperidine |
| SMILES | C=C(F)C(F)(N1CC(C(F)(F)F)CC(C(F)(F)F)C1)C(F)(F)F |
| InChI | InChI=1S/C11H10F11N/c1-5(12)8(13,11(20,21)22)23-3-6(9(14,15)16)2-7(4-23)10(17,18)19/h6-7H,1-4H2 |
| InChIKey | MYGMLRARGHQMIH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|