C26H28N4 — CID 166781489
4-[2-[3-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]phenyl]ethyl]benzenecarboximidamide (PubChem CID 166781489) has the molecular formula C26H28N4 and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-[2-[3-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]phenyl]ethyl]benzenecarboximidamide.
| Compound Name | 4-[2-[3-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]phenyl]ethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 166781489 |
| Molecular Formula | C26H28N4 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 4-[2-[3-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]phenyl]ethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2cccc(CCc3ccc(C4=NCCN4)cc3)c2)cc1 |
| InChI | InChI=1S/C26H28N4/c27-25(28)23-12-8-19(9-13-23)4-6-21-2-1-3-22(18-21)7-5-20-10-14-24(15-11-20)26-29-16-17-30-26/h1-3,8-15,18H,4-7,16-17H2,(H3,27,28)(H,29,30) |
| InChIKey | OSTZTYQPNQJDKG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|