C17H31NO — CID 166783303
7-tert-butyl-3-methyl-3-propyl-1,4,4a,5,6,7,8,8a-octahydroquinolin-2-one (PubChem CID 166783303) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is 7-tert-butyl-3-methyl-3-propyl-1,4,4a,5,6,7,8,8a-octahydroquinolin-2-one.
| Compound Name | 7-tert-butyl-3-methyl-3-propyl-1,4,4a,5,6,7,8,8a-octahydroquinolin-2-one |
|---|---|
| PubChem CID | 166783303 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 7-tert-butyl-3-methyl-3-propyl-1,4,4a,5,6,7,8,8a-octahydroquinolin-2-one |
| SMILES | CCCC1(C)CC2CCC(C(C)(C)C)CC2NC1=O |
| InChI | InChI=1S/C17H31NO/c1-6-9-17(5)11-12-7-8-13(16(2,3)4)10-14(12)18-15(17)19/h12-14H,6-11H2,1-5H3,(H,18,19) |
| InChIKey | RXKJKZSZBUEBMW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |