C16H26FN — CID 166788584
N-[(2E)-3-ethenyl-4-methylpenta-2,4-dien-2-yl]-4-fluoro-N,4-dimethylcyclohexan-1-amine (PubChem CID 166788584) has the molecular formula C16H26FN and a molecular weight of 251.39 g/mol. Its IUPAC name is N-[(2E)-3-ethenyl-4-methylpenta-2,4-dien-2-yl]-4-fluoro-N,4-dimethylcyclohexan-1-amine.
| Compound Name | N-[(2E)-3-ethenyl-4-methylpenta-2,4-dien-2-yl]-4-fluoro-N,4-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 166788584 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | N-[(2E)-3-ethenyl-4-methylpenta-2,4-dien-2-yl]-4-fluoro-N,4-dimethylcyclohexan-1-amine |
| SMILES | C=C/C(C(=C)C)=C(/C)N(C)C1CCC(C)(F)CC1 |
| InChI | InChI=1S/C16H26FN/c1-7-15(12(2)3)13(4)18(6)14-8-10-16(5,17)11-9-14/h7,14H,1-2,8-11H2,3-6H3/b15-13+ |
| InChIKey | SJUYWXMVDNXNSC-FYWRMAATSA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|