C27H30Cl2F2N3O10P — CID 166789440
[1,4-bis[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[2.2.2]octanyl]-(2-phosphonooxyethyl)carbamic acid (PubChem CID 166789440) has the molecular formula C27H30Cl2F2N3O10P and a molecular weight of 696.42 g/mol. Its IUPAC name is [1,4-bis[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[2.2.2]octanyl]-(2-phosphonooxyethyl)carbamic acid.
| Compound Name | [1,4-bis[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[2.2.2]octanyl]-(2-phosphonooxyethyl)carbamic acid |
|---|---|
| PubChem CID | 166789440 |
| Molecular Formula | C27H30Cl2F2N3O10P |
| Molecular Weight | 696.42 g/mol |
| Exact Mass | 695.10 |
| IUPAC Name | [1,4-bis[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[2.2.2]octanyl]-(2-phosphonooxyethyl)carbamic acid |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)NC12CCC(NC(=O)COc3ccc(Cl)c(F)c3)(CC1)C(N(CCOP(=O)(O)O)C(=O)O)C2 |
| InChI | InChI=1S/C27H30Cl2F2N3O10P/c28-18-3-1-16(11-20(18)30)42-14-23(35)32-26-5-7-27(8-6-26,22(13-26)34(25(37)38)9-10-44-45(39,40)41)33-24(36)15-43-17-2-4-19(29)21(31)12-17/h1-4,11-12,22H,5-10,13-15H2,(H,32,35)(H,33,36)(H,37,38)(H2,39,40,41) |
| InChIKey | AYWBIIIEBGBBON-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 183.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|