C19H24N2O4S2 — CID 166793956
[3-[1-(3-methylsulfonylphenyl)piperidin-3-yl]sulfonylphenyl]methanamine (PubChem CID 166793956) has the molecular formula C19H24N2O4S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is [3-[1-(3-methylsulfonylphenyl)piperidin-3-yl]sulfonylphenyl]methanamine.
| Compound Name | [3-[1-(3-methylsulfonylphenyl)piperidin-3-yl]sulfonylphenyl]methanamine |
|---|---|
| PubChem CID | 166793956 |
| Molecular Formula | C19H24N2O4S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [3-[1-(3-methylsulfonylphenyl)piperidin-3-yl]sulfonylphenyl]methanamine |
| SMILES | CS(=O)(=O)c1cccc(N2CCCC(S(=O)(=O)c3cccc(CN)c3)C2)c1 |
| InChI | InChI=1S/C19H24N2O4S2/c1-26(22,23)17-7-3-6-16(12-17)21-10-4-9-19(14-21)27(24,25)18-8-2-5-15(11-18)13-20/h2-3,5-8,11-12,19H,4,9-10,13-14,20H2,1H3 |
| InChIKey | MNZYINZCGHMDCP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |