C21H25N3O6 — CID 166797449
N-cyclopentyl-7-[2-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]-1H-indazole-5-carboxamide (PubChem CID 166797449) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is N-cyclopentyl-7-[2-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]-1H-indazole-5-carboxamide.
| Compound Name | N-cyclopentyl-7-[2-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 166797449 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-cyclopentyl-7-[2-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]-1H-indazole-5-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cc(C#CC2OC(CO)[C@@H](O)C(O)C2O)c2[nH]ncc2c1 |
| InChI | InChI=1S/C21H25N3O6/c25-10-16-19(27)20(28)18(26)15(30-16)6-5-11-7-12(8-13-9-22-24-17(11)13)21(29)23-14-3-1-2-4-14/h7-9,14-16,18-20,25-28H,1-4,10H2,(H,22,24)(H,23,29)/t15?,16?,18?,19-,20?/m1/s1 |
| InChIKey | SIQRQWRUMYQXCO-KCKAIOALSA-N |
| XLogP | -0.57 |
| TPSA | 147.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|