C28H25FN4O2 — CID 166810153
5-(2-fluoro-6-methoxyphenyl)-3-(3-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl)-1H-indole-6-carbonitrile (PubChem CID 166810153) has the molecular formula C28H25FN4O2 and a molecular weight of 468.53 g/mol. Its IUPAC name is 5-(2-fluoro-6-methoxyphenyl)-3-(3-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl)-1H-indole-6-carbonitrile.
| Compound Name | 5-(2-fluoro-6-methoxyphenyl)-3-(3-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl)-1H-indole-6-carbonitrile |
|---|---|
| PubChem CID | 166810153 |
| Molecular Formula | C28H25FN4O2 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 5-(2-fluoro-6-methoxyphenyl)-3-(3-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl)-1H-indole-6-carbonitrile |
| SMILES | COc1cccc(F)c1-c1cc2c(-c3ccc4c(c3)OCC3CN(C)CCN43)c[nH]c2cc1C#N |
| InChI | InChI=1S/C28H25FN4O2/c1-32-8-9-33-19(15-32)16-35-27-11-17(6-7-25(27)33)22-14-31-24-10-18(13-30)20(12-21(22)24)28-23(29)4-3-5-26(28)34-2/h3-7,10-12,14,19,31H,8-9,15-16H2,1-2H3 |
| InChIKey | RSNPCAYNUZUEEP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |