C24H21N7O — CID 166809798
3-(3-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl)-5-pyrazin-2-yl-1H-indazole-6-carbonitrile (PubChem CID 166809798) has the molecular formula C24H21N7O and a molecular weight of 423.48 g/mol. Its IUPAC name is 3-(3-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl)-5-pyrazin-2-yl-1H-indazole-6-carbonitrile.
| Compound Name | 3-(3-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl)-5-pyrazin-2-yl-1H-indazole-6-carbonitrile |
|---|---|
| PubChem CID | 166809798 |
| Molecular Formula | C24H21N7O |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-(3-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl)-5-pyrazin-2-yl-1H-indazole-6-carbonitrile |
| SMILES | CN1CCN2c3ccc(-c4n[nH]c5cc(C#N)c(-c6cnccn6)cc45)cc3OCC2C1 |
| InChI | InChI=1S/C24H21N7O/c1-30-6-7-31-17(13-30)14-32-23-9-15(2-3-22(23)31)24-19-10-18(21-12-26-4-5-27-21)16(11-25)8-20(19)28-29-24/h2-5,8-10,12,17H,6-7,13-14H2,1H3,(H,28,29) |
| InChIKey | DNYBQTPNLLIVRD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |