C12H17N3O — CID 167192471
(10S)-5,12-dimethyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene (PubChem CID 167192471) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is (10S)-5,12-dimethyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene.
| Compound Name | (10S)-5,12-dimethyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 167192471 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (10S)-5,12-dimethyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene |
| SMILES | Cc1cnc2c(c1)OC[C@@H]1CN(C)CCN21 |
| InChI | InChI=1S/C12H17N3O/c1-9-5-11-12(13-6-9)15-4-3-14(2)7-10(15)8-16-11/h5-6,10H,3-4,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | FAPHNQSRATXDGG-JTQLQIEISA-N |
| XLogP | 0.90 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |