C30H30FN5O — CID 166810159
5-[2-fluoro-6-methyl-4-(methylaminomethyl)phenyl]-3-(3-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl)-1H-indole-6-carbonitrile (PubChem CID 166810159) has the molecular formula C30H30FN5O and a molecular weight of 495.60 g/mol. Its IUPAC name is 5-[2-fluoro-6-methyl-4-(methylaminomethyl)phenyl]-3-(3-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl)-1H-indole-6-carbonitrile.
| Compound Name | 5-[2-fluoro-6-methyl-4-(methylaminomethyl)phenyl]-3-(3-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl)-1H-indole-6-carbonitrile |
|---|---|
| PubChem CID | 166810159 |
| Molecular Formula | C30H30FN5O |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 5-[2-fluoro-6-methyl-4-(methylaminomethyl)phenyl]-3-(3-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl)-1H-indole-6-carbonitrile |
| SMILES | CNCc1cc(C)c(-c2cc3c(-c4ccc5c(c4)OCC4CN(C)CCN54)c[nH]c3cc2C#N)c(F)c1 |
| InChI | InChI=1S/C30H30FN5O/c1-18-8-19(14-33-2)9-26(31)30(18)23-12-24-25(15-34-27(24)10-21(23)13-32)20-4-5-28-29(11-20)37-17-22-16-35(3)6-7-36(22)28/h4-5,8-12,15,22,33-34H,6-7,14,16-17H2,1-3H3 |
| InChIKey | FISRCOQEOOEUIV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 67.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |