C10H13N5OS — CID 166810256
2-ethylsulfinyl-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine (PubChem CID 166810256) has the molecular formula C10H13N5OS and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-ethylsulfinyl-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine.
| Compound Name | 2-ethylsulfinyl-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 166810256 |
| Molecular Formula | C10H13N5OS |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-ethylsulfinyl-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine |
| SMILES | CCS(=O)c1nccc(Nc2cc(C)[nH]n2)n1 |
| InChI | InChI=1S/C10H13N5OS/c1-3-17(16)10-11-5-4-8(13-10)12-9-6-7(2)14-15-9/h4-6H,3H2,1-2H3,(H2,11,12,13,14,15) |
| InChIKey | GEGXXAQOPJFJAT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |