C10H11BrN4 — CID 154684827
6-bromo-4-methyl-N-(5-methyl-1H-pyrazol-3-yl)pyridin-2-amine (PubChem CID 154684827) has the molecular formula C10H11BrN4 and a molecular weight of 267.13 g/mol. Its IUPAC name is 6-bromo-4-methyl-N-(5-methyl-1H-pyrazol-3-yl)pyridin-2-amine.
| Compound Name | 6-bromo-4-methyl-N-(5-methyl-1H-pyrazol-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 154684827 |
| Molecular Formula | C10H11BrN4 |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 6-bromo-4-methyl-N-(5-methyl-1H-pyrazol-3-yl)pyridin-2-amine |
| SMILES | Cc1cc(Br)nc(Nc2cc(C)[nH]n2)c1 |
| InChI | InChI=1S/C10H11BrN4/c1-6-3-8(11)12-9(4-6)13-10-5-7(2)14-15-10/h3-5H,1-2H3,(H2,12,13,14,15) |
| InChIKey | VJDQQJPRYKRDMK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|