C9H10ClN5O2S — CID 87622938
2-chloro-N-(5-methyl-1H-pyrazol-3-yl)-6-methylsulfonylpyrimidin-4-amine (PubChem CID 87622938) has the molecular formula C9H10ClN5O2S and a molecular weight of 287.73 g/mol. Its IUPAC name is 2-chloro-N-(5-methyl-1H-pyrazol-3-yl)-6-methylsulfonylpyrimidin-4-amine.
| Compound Name | 2-chloro-N-(5-methyl-1H-pyrazol-3-yl)-6-methylsulfonylpyrimidin-4-amine |
|---|---|
| PubChem CID | 87622938 |
| Molecular Formula | C9H10ClN5O2S |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-chloro-N-(5-methyl-1H-pyrazol-3-yl)-6-methylsulfonylpyrimidin-4-amine |
| SMILES | Cc1cc(Nc2cc(S(C)(=O)=O)nc(Cl)n2)n[nH]1 |
| InChI | InChI=1S/C9H10ClN5O2S/c1-5-3-7(15-14-5)11-6-4-8(18(2,16)17)13-9(10)12-6/h3-4H,1-2H3,(H2,11,12,13,14,15) |
| InChIKey | LWCKHEKLGKYYMD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |