C9H7ClN6 — CID 164830024
3-chloro-5-[(5-methyl-1H-pyrazol-3-yl)amino]pyrazine-2-carbonitrile (PubChem CID 164830024) has the molecular formula C9H7ClN6 and a molecular weight of 234.65 g/mol. Its IUPAC name is 3-chloro-5-[(5-methyl-1H-pyrazol-3-yl)amino]pyrazine-2-carbonitrile.
| Compound Name | 3-chloro-5-[(5-methyl-1H-pyrazol-3-yl)amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 164830024 |
| Molecular Formula | C9H7ClN6 |
| Molecular Weight | 234.65 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 3-chloro-5-[(5-methyl-1H-pyrazol-3-yl)amino]pyrazine-2-carbonitrile |
| SMILES | Cc1cc(Nc2cnc(C#N)c(Cl)n2)n[nH]1 |
| InChI | InChI=1S/C9H7ClN6/c1-5-2-7(16-15-5)13-8-4-12-6(3-11)9(10)14-8/h2,4H,1H3,(H2,13,14,15,16) |
| InChIKey | CJYQBTAINUSEAO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.65 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |