C20H20ClN5 — CID 88956087
2-chloro-4-[4-(2-methylpropyl)phenyl]-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyridine-3-carbonitrile (PubChem CID 88956087) has the molecular formula C20H20ClN5 and a molecular weight of 365.87 g/mol. Its IUPAC name is 2-chloro-4-[4-(2-methylpropyl)phenyl]-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyridine-3-carbonitrile.
| Compound Name | 2-chloro-4-[4-(2-methylpropyl)phenyl]-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 88956087 |
| Molecular Formula | C20H20ClN5 |
| Molecular Weight | 365.87 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-chloro-4-[4-(2-methylpropyl)phenyl]-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyridine-3-carbonitrile |
| SMILES | Cc1cc(Nc2cc(-c3ccc(CC(C)C)cc3)c(C#N)c(Cl)n2)n[nH]1 |
| InChI | InChI=1S/C20H20ClN5/c1-12(2)8-14-4-6-15(7-5-14)16-10-18(24-20(21)17(16)11-22)23-19-9-13(3)25-26-19/h4-7,9-10,12H,8H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | GPDNKLIHIWLATP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.87 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|