C11H10ClN5 — CID 11983545
2-chloro-4-methyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyridine-3-carbonitrile (PubChem CID 11983545) has the molecular formula C11H10ClN5 and a molecular weight of 247.69 g/mol. Its IUPAC name is 2-chloro-4-methyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyridine-3-carbonitrile.
| Compound Name | 2-chloro-4-methyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 11983545 |
| Molecular Formula | C11H10ClN5 |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-chloro-4-methyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyridine-3-carbonitrile |
| SMILES | Cc1cc(Nc2cc(C)c(C#N)c(Cl)n2)n[nH]1 |
| InChI | InChI=1S/C11H10ClN5/c1-6-3-9(15-11(12)8(6)5-13)14-10-4-7(2)16-17-10/h3-4H,1-2H3,(H2,14,15,16,17) |
| InChIKey | NLMXNFQXIDBOFX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|