C17H18N8O — CID 67098729
4-methyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-(2-pyrimidin-2-yloxyethylamino)pyridine-3-carbonitrile (PubChem CID 67098729) has the molecular formula C17H18N8O and a molecular weight of 350.39 g/mol. Its IUPAC name is 4-methyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-(2-pyrimidin-2-yloxyethylamino)pyridine-3-carbonitrile.
| Compound Name | 4-methyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-(2-pyrimidin-2-yloxyethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 67098729 |
| Molecular Formula | C17H18N8O |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 4-methyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-(2-pyrimidin-2-yloxyethylamino)pyridine-3-carbonitrile |
| SMILES | Cc1cc(Nc2cc(C)c(C#N)c(NCCOc3ncccn3)n2)n[nH]1 |
| InChI | InChI=1S/C17H18N8O/c1-11-8-14(22-15-9-12(2)24-25-15)23-16(13(11)10-18)19-6-7-26-17-20-4-3-5-21-17/h3-5,8-9H,6-7H2,1-2H3,(H3,19,22,23,24,25) |
| InChIKey | KMFLPEBGAXVVCJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|