C9H11ClN4 — CID 142756409
2-chloro-6-(2-ethylhydrazinyl)-4-methylpyridine-3-carbonitrile (PubChem CID 142756409) has the molecular formula C9H11ClN4 and a molecular weight of 210.67 g/mol. Its IUPAC name is 2-chloro-6-(2-ethylhydrazinyl)-4-methylpyridine-3-carbonitrile.
| Compound Name | 2-chloro-6-(2-ethylhydrazinyl)-4-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 142756409 |
| Molecular Formula | C9H11ClN4 |
| Molecular Weight | 210.67 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2-chloro-6-(2-ethylhydrazinyl)-4-methylpyridine-3-carbonitrile |
| SMILES | CCNNc1cc(C)c(C#N)c(Cl)n1 |
| InChI | InChI=1S/C9H11ClN4/c1-3-12-14-8-4-6(2)7(5-11)9(10)13-8/h4,12H,3H2,1-2H3,(H,13,14) |
| InChIKey | XYSAIAKHZURBRL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.67 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|