About N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide
N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide (PubChem CID 16763454) has the molecular formula C13H17ClN4O
and a molecular weight of 280.76 g/mol. Its IUPAC name is N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide.
Molecular Properties
| Compound Name | N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide |
| PubChem CID | 16763454 |
| Molecular Formula | C13H17ClN4O |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide |
| SMILES | CCCC(=O)NN(CC)c1cc(C)c(C#N)c(Cl)n1 |
| InChI | InChI=1S/C13H17ClN4O/c1-4-6-12(19)17-18(5-2)11-7-9(3)10(8-15)13(14)16-11/h7H,4-6H2,1-3H3,(H,17,19) |
| InChIKey | XJIQJGMCVOYPOK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide?
The IUPAC name of N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide (CID 16763454) is N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide.
What is the SMILES notation for N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide?
The canonical SMILES for N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide is CCCC(=O)NN(CC)c1cc(C)c(C#N)c(Cl)n1.
What is the InChIKey of N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide?
The InChIKey is XJIQJGMCVOYPOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN4O/c1-4-6-12(19)17-18(5-2)11-7-9(3)10(8-15)13(14)16-11/h7H,4-6H2,1-3H3,(H,17,19).
What are the key properties of N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide?
N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide has a molecular weight of 280.76 g/mol, XLogP of 2.57, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6-chloro-5-cyano-4-methyl-2-pyridinyl)-N'-ethylbutanehydrazide is sourced from PubChem (CID 16763454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).