C12H16ClN5O — CID 5160224
1-butyl-3-[(6-chloro-3-cyano-4-methyl-2-pyridinyl)amino]urea (PubChem CID 5160224) has the molecular formula C12H16ClN5O and a molecular weight of 281.75 g/mol. Its IUPAC name is 1-butyl-3-[(6-chloro-3-cyano-4-methyl-2-pyridinyl)amino]urea.
| Compound Name | 1-butyl-3-[(6-chloro-3-cyano-4-methyl-2-pyridinyl)amino]urea |
|---|---|
| PubChem CID | 5160224 |
| Molecular Formula | C12H16ClN5O |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 1-butyl-3-[(6-chloro-3-cyano-4-methyl-2-pyridinyl)amino]urea |
| SMILES | CCCCNC(=O)NNc1nc(Cl)cc(C)c1C#N |
| InChI | InChI=1S/C12H16ClN5O/c1-3-4-5-15-12(19)18-17-11-9(7-14)8(2)6-10(13)16-11/h6H,3-5H2,1-2H3,(H,16,17)(H2,15,18,19) |
| InChIKey | IMEAUGLPIKTILJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|