C19H34N4O — CID 67288173
N-butyl-2,6-bis(butylamino)-4-methylpyridine-3-carboxamide (PubChem CID 67288173) has the molecular formula C19H34N4O and a molecular weight of 334.51 g/mol. Its IUPAC name is N-butyl-2,6-bis(butylamino)-4-methylpyridine-3-carboxamide.
| Compound Name | N-butyl-2,6-bis(butylamino)-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 67288173 |
| Molecular Formula | C19H34N4O |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | N-butyl-2,6-bis(butylamino)-4-methylpyridine-3-carboxamide |
| SMILES | CCCCNC(=O)c1c(C)cc(NCCCC)nc1NCCCC |
| InChI | InChI=1S/C19H34N4O/c1-5-8-11-20-16-14-15(4)17(19(24)22-13-10-7-3)18(23-16)21-12-9-6-2/h14H,5-13H2,1-4H3,(H,22,24)(H2,20,21,23) |
| InChIKey | WFMSZULNLFDHQO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|