C12H18ClN3O — CID 593495
1-butyl-3-(2-chloro-4,6-dimethyl-3-pyridinyl)urea (PubChem CID 593495) has the molecular formula C12H18ClN3O and a molecular weight of 255.75 g/mol. Its IUPAC name is 1-butyl-3-(2-chloro-4,6-dimethyl-3-pyridinyl)urea.
| Compound Name | 1-butyl-3-(2-chloro-4,6-dimethyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 593495 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-butyl-3-(2-chloro-4,6-dimethyl-3-pyridinyl)urea |
| SMILES | CCCCNC(=O)Nc1c(C)cc(C)nc1Cl |
| InChI | InChI=1S/C12H18ClN3O/c1-4-5-6-14-12(17)16-10-8(2)7-9(3)15-11(10)13/h7H,4-6H2,1-3H3,(H2,14,16,17) |
| InChIKey | KDZYFAPBALJGPO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|