C15H22ClN3O2 — CID 111618243
1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1-hydroxycyclohexyl)methyl]urea (PubChem CID 111618243) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1-hydroxycyclohexyl)methyl]urea.
| Compound Name | 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1-hydroxycyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 111618243 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1-hydroxycyclohexyl)methyl]urea |
| SMILES | Cc1cc(C)c(NC(=O)NCC2(O)CCCCC2)c(Cl)n1 |
| InChI | InChI=1S/C15H22ClN3O2/c1-10-8-11(2)18-13(16)12(10)19-14(20)17-9-15(21)6-4-3-5-7-15/h8,21H,3-7,9H2,1-2H3,(H2,17,19,20) |
| InChIKey | JNMGTPYWBSYIIW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|